Flag of the United StatesAmerican Chemical Independence

(Oxolan-2-yl)methyl 2-sulfanylpropanoate

CAS 99253-91-5

EPA and Census publish no US supply data for this chemical.

Molecular structure of 99253-91-5
US productionNot reported
Top sourceNo public record

This chemical is not on EPA’s Toxic Substances Control Act inventory, the list behind EPA’s production survey.

Why supply is unknown

No public supply or use records

Neither EPA production reports, Census trade data nor FDA listings cover this chemical, so no one publishes where the US gets it or what it goes into. Why supply is unknown

Chemical Identity

CAS99253-91-5
PubChem CIDNot recorded
DTXSIDDTXSID00912816
FormulaC8H14O3S
Mol. Weight190.26 g/mol
SMILESCC(S)C(=O)OCC1CCCO1

Data Sources

← Back to Dashboard

Brief citations

(Oxolan-2-yl)methyl 2-sulfanylpropanoate (CAS 99253-91-5) https://chemicalindependence.com/chemical/99253-91-5/ EPA CompTox (DSSTox): 99253-91-5. Retrieved 2026-04-29. https://comptox.epa.gov/dashboard/chemical/details/DTXSID00912816