Benzoic acid, 3-hydroxy-
Where It Comes From
No data available
Why It Matters
No data available
Vendor Pricing
$0.02/gAaron Chemicals LLC
CountryHong Kong
Pack$22.00 / 1 kg
Purity99%
Vendors35 available
Prices reflect listed pack sizes. Small research packs run far above bulk rates.
34 more vendors
| Vendor | Country Supplier country. Where available, shows shipping origin. When the supplier ships from a different country than where they are registered, both are shown. Most suppliers show registration country only. | $/g | Pack | Purity |
|---|---|---|---|---|
| Angene Chemical | China → Hong Kong | $0.02 | 1 kg | 99% |
| A2B Chem LLC | United States | $0.02 | 1 kg | 98% |
| AA BLOCKS | United States | $0.03 | 1 kg | 98% |
| BLD Pharmatech Co., Limited | United States | $0.03 | 1 kg | 97% |
| BLD Pharmatech GmbH | Germany | $0.03 | 1 kg | 97% |
| BLD Pharmatech Ltd. | China | $0.03 | 1 kg | 97% |
| Ambeed, Inc. | United States | $0.03 | 1 kg | 97% |
| Chemscene | United States | $0.05 | 1 kg | — |
| Fluorochem EU | Germany | $0.06 | 1 kg | 95% |
| Fluorochem UK | United Kingdom | $0.10 | 100 g | 95% |
| AK Scientific Specialized | United States | $0.17 | 500 g | 97% |
| AK Scientific, Inc. | United States | $0.23 | 500 g | 98% |
| Combi-Blocks, Inc. | United States | $0.25 | 1 kg | 98% |
| Apollo Scientific US | United Kingdom | $0.27 | 1 kg | 99% |
| MedChemExpress MCE | Sweden | $0.29 | 1 kg | 99.95% |
| ALFA AESAR | Germany | $0.36 | 500 g | 99% |
| Angene International Limited | United States | $0.43 | 500 g | 98% |
| Sigma-Aldrich (Rush Stock) | Germany | $0.46 | 500 g | 99% |
| Sigma-Aldrich | Germany | $0.46 | 500 g | 99% |
| Aldlab | United States | $0.66 | 25 g | 95% |
| Apexbio Technology LLC | United States | $10.00 | 5 g | 99.85% |
| Interbioscreen | Hong Kong | $24.00 | 10 g | 95% |
| TargetMol Chemicals | China → United States | $40.00 | 1 g | 99.66% |
| Molnova | China | $70.00 | 500 mg | 99% |
| Labotest KG | Germany | $217.80 | 5000 mg | 90% |
| Specs | Netherlands | $376.31 | 1 g | 90% |
| ChemFaces | China | $1500.00 | 20 mg | 98% |
| Otava, Ltd. | Ukraine | $2280.00 | 50 mg | 95% |
| Otava, Ltd. (2 weeks) | Ukraine | $2724.00 | 50 mg | 95% |
| Key Organics Ltd. | United Kingdom | $2740.00 | 50 mg | 97% |
| Angene | China → Hong Kong | $4266.67 | 30 mg | 99% |
| Asinex | Netherlands | $6461.40 | 100 mg | 90% |
| TimTec, LLC (back-ordered) | United States | $32000.00 | 15 mg | 94% |
| AnalytiCon Discovery - a Division of BRAIN Biotech AG | Germany | $108077.20 | 50 mg | 85% |
Chemical Identity
CAS99-06-9
PubChem CIDNo data available
DTXSIDDTXSID6021610
FormulaC7H6O3
Mol. Weight138.122 g/mol
SMILESOC(=O)C1=CC(O)=CC=C1
Data Sources
CAS 99-06-92026-04-29
https://www.epa.gov/tsca-inventory
Archive: data/sources/tsca/tsca_inventory.csv