Flag of the United StatesAmerican Chemical Independence

7-(1-Ethoxyethoxy)-4,10-dimethyl-3,5,9,11-tetraoxatridecane

CAS 67715-82-6

EPA and Census publish no US supply data for this chemical.

Molecular structure of 67715-82-6
US productionNot reported
Top sourceNo public record

This chemical is not on EPA’s Toxic Substances Control Act inventory, the list behind EPA’s production survey.

Why supply is unknown

No public supply or use records

Neither EPA production reports, Census trade data nor FDA listings cover this chemical, so no one publishes where the US gets it or what it goes into. Why supply is unknown

Chemical Identity

CAS67715-82-6
PubChem CIDNot recorded
DTXSIDDTXSID00867317
FormulaC15H32O6
Mol. Weight308.415 g/mol
SMILESCCOC(C)OCC(COC(C)OCC)OC(C)OCC

Data Sources

← Back to Dashboard

Brief citations

7-(1-Ethoxyethoxy)-4,10-dimethyl-3,5,9,11-tetraoxatridecane (CAS 67715-82-6) https://chemicalindependence.com/chemical/67715-82-6/ EPA CompTox (DSSTox): 67715-82-6. Retrieved 2026-04-29. https://comptox.epa.gov/dashboard/chemical/details/DTXSID00867317