4H-1-Benzopyran-4-one, 3-hydroxy-2-phenyl-
Where It Comes From
No data available
Why It Matters
No data available
Vendor Pricing
$2.83/gAaron Chemicals LLC
CountryHong Kong
Pack$283.00 / 100 g
Purity98%
Vendors28 available
Prices reflect listed pack sizes. Small research packs run far above bulk rates.
27 more vendors
| Vendor | Country Supplier country. Where available, shows shipping origin. When the supplier ships from a different country than where they are registered, both are shown. Most suppliers show registration country only. | $/g | Pack | Purity |
|---|---|---|---|---|
| Angene Chemical | China → Hong Kong | $2.86 | 100 g | 98% |
| Combi-Blocks, Inc. | United States | $4.60 | 100 g | 98% |
| Fluorochem EU | Germany | $5.13 | 25 g | 98% |
| BLD Pharmatech Ltd. | China | $5.25 | 100 g | 95% |
| A2B Chem LLC | United States | $5.80 | 5 g | 95% |
| AA BLOCKS | United States | $6.40 | 5 g | 95% |
| BLD Pharmatech GmbH | Germany | $7.00 | 25 g | 95% |
| BLD Pharmatech Co., Limited | United States | $7.50 | 10 g | 95% |
| Ambeed, Inc. | United States | $7.50 | 10 g | 95% |
| AK Scientific, Inc. | United States | $9.08 | 100 g | 98% |
| AstaTech, Inc | United States | $15.44 | 25 g | 95% |
| ALFA AESAR | Germany | $21.86 | 5 g | 98% |
| Sigma-Aldrich (Rush Stock) | Germany | $25.96 | 5 g | 98% |
| Sigma-Aldrich | Germany | $25.96 | 5 g | 98% |
| Cayman Europe | Estonia | $26.42 | 10 g | 98% |
| Angene International Limited | United States | $26.52 | 25 g | 99% |
| TargetMol Chemicals | China → United States | $31.00 | 1 g | 99.94% |
| MedChemExpress MCE | Sweden | $49.61 | 1 g | 99.92% |
| Chengdu Biopurify Phytochemicals Ltd. | China | $118.00 | 1 g | 98% |
| AK Scientific Specialized | United States | $890.00 | 100 mg | 99% |
| ChemFaces | China | $1500.00 | 20 mg | 98% |
| Otava, Ltd. | Ukraine | $2724.00 | 50 mg | 95% |
| Angene | China → Hong Kong | $4266.67 | 30 mg | 98% |
| Asinex | Netherlands | $6461.40 | 100 mg | 90% |
| Key Organics Ltd. | United Kingdom | $6900.00 | 10 mg | 98% |
| TimTec, LLC | United States | $9333.33 | 30 mg | 98% |
| AnalytiCon Discovery - a Division of BRAIN Biotech AG | Germany | $73652.70 | 100 mg | 85% |
Chemical Identity
CAS577-85-5
PubChem CIDNo data available
DTXSIDDTXSID4060365
FormulaC15H10O3
Mol. Weight238.242 g/mol
SMILESOC1=C(OC2=CC=CC=C2C1=O)C1=CC=CC=C1
Data Sources
CAS 577-85-52026-04-29
https://www.epa.gov/tsca-inventory
Archive: data/sources/tsca/tsca_inventory.csv