Flag of the United StatesAmerican Chemical Independence

N,N-Diethyl-2-(4-methylbenzyloxy) ethylamine hydrochloride

CAS 274671-61-3

EPA and Census publish no US supply data for this chemical.

Molecular structure of 274671-61-3
1 HCl
US productionNot reported
Top sourceNo public record

This chemical is not on EPA’s Toxic Substances Control Act inventory, the list behind EPA’s production survey.

Why supply is unknown

No public supply or use records

Neither EPA production reports, Census trade data nor FDA listings cover this chemical, so no one publishes where the US gets it or what it goes into. Why supply is unknown

Chemical Identity

CAS274671-61-3
PubChem CIDNot recorded
DTXSIDDTXSID9035969
FormulaC14H24ClNO
Mol. Weight257.8 g/mol
SMILESCl.CCN(CC)CCOCC1=CC=C(C)C=C1

Data Sources

← Back to Dashboard

Brief citations

N,N-Diethyl-2-(4-methylbenzyloxy) ethylamine hydrochloride (CAS 274671-61-3) https://chemicalindependence.com/chemical/274671-61-3/ EPA CompTox (DSSTox): 274671-61-3. Retrieved 2026-04-29. https://comptox.epa.gov/dashboard/chemical/details/DTXSID9035969