β-D-Glucopyranoside, 2-(hydroxymethyl)phenyl
Where It Comes From
No data available
Why It Matters
No data available
Vendor Pricing
$0.50/gCombi-Blocks, Inc.
CountryUnited States
Pack$250.00 / 500 g
Purity98%
Vendors31 available
Prices reflect listed pack sizes. Small research packs run far above bulk rates.
30 more vendors
| Vendor | Country Supplier country. Where available, shows shipping origin. When the supplier ships from a different country than where they are registered, both are shown. Most suppliers show registration country only. | $/g | Pack | Purity |
|---|---|---|---|---|
| BLD Pharmatech GmbH | Germany | $0.59 | 500 g | 98% |
| BLD Pharmatech Ltd. | China | $0.59 | 500 g | 98% |
| AK Scientific Specialized | United States | $0.59 | 500 g | 97% |
| A2B Chem LLC | United States | $0.63 | 500 g | 98% |
| AA BLOCKS | United States | $0.67 | 500 g | 98% |
| Aaron Chemicals LLC | Hong Kong | $0.77 | 100 g | 98% |
| AK Scientific, Inc. | United States | $0.78 | 500 g | 99% |
| Apollo Scientific UK | United Kingdom | $0.86 | 2.5 kg | 98% |
| Angene Chemical | China → Hong Kong | $0.90 | 100 g | 98% |
| AstaTech (2 weeks) | United States | $1.26 | 500 g | 95% |
| Angene International Limited | United States | $1.26 | 500 g | 99% |
| Ambeed, Inc. | United States | $1.40 | 25 g | 98% |
| BLD Pharmatech Co., Limited | United States | $1.40 | 25 g | 98% |
| Cayman Europe | Estonia | $5.21 | 100 g | 98% |
| ALFA AESAR | Germany | $5.86 | 100 g | 99% |
| MedChemExpress MCE | Sweden | $6.29 | 10 g | 99.77% |
| Fluorochem UK | United Kingdom | $12.87 | 1 g | 95% |
| Sigma-Aldrich (Rush Stock) | Germany | $15.02 | 100 g | 99% |
| Sigma-Aldrich | Germany | $15.02 | 100 g | 99% |
| MedKoo Biosciences, Inc | United States | $50.00 | 10 g | 98% |
| Apexbio Technology LLC | United States | $102.00 | 500 mg | 95.03% |
| Chengdu Biopurify Phytochemicals Ltd. | China | $118.00 | 1 g | 98% |
| Interbioscreen | Hong Kong | $211.00 | 10 g | 95% |
| Labotest KG | Germany | $217.80 | 5000 mg | 90% |
| Molnova | China | $740.00 | 50 mg | 99% |
| ChemFaces | China | $1500.00 | 20 mg | 98% |
| Angene | China → Hong Kong | $4266.67 | 30 mg | 98% |
| Key Organics Ltd. | United Kingdom | $6900.00 | 10 mg | 98% |
| Vitas M Chemical Limited | Hong Kong | $25500.00 | 2 mg | 90% |
| AnalytiCon Discovery - a Division of BRAIN Biotech AG | Germany | $73652.70 | 100 mg | 85% |
Chemical Identity
CAS138-52-3
PubChem CIDNo data available
DTXSIDDTXSID10883326
FormulaC13H18O7
Mol. Weight286.28 g/mol
SMILESOC[C@H]1O[C@@H](OC2=C(CO)C=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O
Data Sources
CAS 138-52-32026-04-29
https://www.epa.gov/tsca-inventory
Archive: data/sources/tsca/tsca_inventory.csv