Benzaldehyde, 4-hydroxy-3,5-dimethoxy-
Where It Comes From
No data available
Why It Matters
No data available
Vendor Pricing
$0.07/gAaron Chemicals LLC
CountryHong Kong
Pack$37.00 / 500 g
Purity98%
Vendors40 available
Prices reflect listed pack sizes. Small research packs run far above bulk rates.
39 more vendors
| Vendor | Country Supplier country. Where available, shows shipping origin. When the supplier ships from a different country than where they are registered, both are shown. Most suppliers show registration country only. | $/g | Pack | Purity |
|---|---|---|---|---|
| A2B Chem LLC | United States | $0.08 | 1 kg | 98% |
| Angene Chemical | China → Hong Kong | $0.08 | 500 g | 98% |
| AA BLOCKS | United States | $0.09 | 1 kg | 98% |
| Chemscene | United States | $0.11 | 1 kg | — |
| BLD Pharmatech Co., Limited | United States | $0.11 | 1 kg | 98% |
| BLD Pharmatech GmbH | Germany | $0.11 | 1 kg | 98% |
| BLD Pharmatech Ltd. | China | $0.11 | 1 kg | 98% |
| Ambeed, Inc. | United States | $0.11 | 1 kg | 98% |
| Fluorochem EU | Germany | $0.14 | 500 g | 95% |
| AK Scientific Specialized | United States | $0.14 | 1 kg | 95% |
| AK Scientific, Inc. | United States | $0.19 | 1 kg | 98% |
| Combi-Blocks, Inc. | United States | $0.25 | 1 kg | 98% |
| Angene International Limited | United States | $0.37 | 500 g | 98% |
| Fluorochem UK | United Kingdom | $0.46 | 25 g | 95% |
| Apollo Scientific UK | United Kingdom | $0.56 | 500 g | 98% |
| Aldlab | United States | $0.67 | 12.5 g | 95% |
| Sigma-Aldrich (Rush Stock) | Germany | $0.76 | 5 kg | 98% |
| Sigma-Aldrich | Germany | $0.76 | 5 kg | 98% |
| AstaTech (2 weeks) | United States | $1.48 | 25 g | 95% |
| MedChemExpress MCE | Sweden | $1.79 | 100 g | 99.96% |
| Cayman Europe | Estonia | $2.71 | 100 g | 98% |
| ALFA AESAR | Germany | $3.28 | 100 g | 98% |
| MedKoo Biosciences, Inc | United States | $7.50 | 100 g | 98% |
| TargetMol Chemicals | China → United States | $29.00 | 1 g | 99.79% |
| Interbioscreen | Hong Kong | $34.00 | 10 g | 95% |
| HTS Biochemie Innovationen | Germany | $120.00 | 10 g | 95% |
| ChemNorm | China | $180.00 | 100 mg | 98% |
| Specs | Netherlands | $181.26 | 5 g | 90% |
| Labotest KG | Germany | $217.80 | 5000 mg | 90% |
| Vitas M Chemical Limited | Hong Kong | $360.00 | 1 g | 90% |
| Molnova | China | $450.00 | 100 mg | 99% |
| ChemFaces | China | $1500.00 | 20 mg | 98% |
| Otava, Ltd. | Ukraine | $2280.00 | 50 mg | 90% |
| Otava, Ltd. (2 weeks) | Ukraine | $2724.00 | 50 mg | 90% |
| Princeton BioMolecular Research (SC) | United States | $2900.00 | 100 mg | 90% |
| Angene | China → Hong Kong | $4266.67 | 30 mg | 98% |
| Asinex | Netherlands | $6461.40 | 100 mg | 90% |
| Key Organics Ltd. | United Kingdom | $6900.00 | 10 mg | 95% |
| AnalytiCon Discovery - a Division of BRAIN Biotech AG | Germany | $177466.67 | 3 mg | 70% |
Chemical Identity
CAS134-96-3
PubChem CIDNo data available
DTXSIDDTXSID2059643
FormulaC9H10O4
Mol. Weight182.175 g/mol
SMILESCOC1=CC(C=O)=CC(OC)=C1O
Data Sources
CAS 134-96-32026-04-29
https://www.epa.gov/tsca-inventory
Archive: data/sources/tsca/tsca_inventory.csv