Flag of the United StatesAmerican Chemical Independence

4-Methyl-2-[4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]-1,3-dioxolane

CAS 121199-28-8

EPA and Census publish no US supply data for this chemical.

Molecular structure of 121199-28-8
US productionNot reported
Top sourceNo public record

This chemical is not on EPA’s Toxic Substances Control Act inventory, the list behind EPA’s production survey.

Why supply is unknown

No public supply or use records

Neither EPA production reports, Census trade data nor FDA listings cover this chemical, so no one publishes where the US gets it or what it goes into. Why supply is unknown

Chemical Identity

CAS121199-28-8
PubChem CIDNot recorded
DTXSIDDTXSID10923711
FormulaC13H20O2
Mol. Weight208.301 g/mol
SMILESCC1COC(O1)C1=CCC(CC1)C(C)=C

Data Sources

← Back to Dashboard

Brief citations

4-Methyl-2-[4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]-1,3-dioxolane (CAS 121199-28-8) https://chemicalindependence.com/chemical/121199-28-8/ EPA CompTox (DSSTox): 121199-28-8. Retrieved 2026-04-29. https://comptox.epa.gov/dashboard/chemical/details/DTXSID10923711