2-Propenoic acid, 2-(phosphonooxy)-, compd. with cyclohexanamine (1:1)
Where It Comes From
No data available
Why It Matters
No data available
Vendor Pricing
$4.35/gCombi-Blocks, Inc.
CountryUnited States
Pack$435.00 / 100 g
Purity95%
Vendors18 available
Prices reflect listed pack sizes. Small research packs run far above bulk rates.
17 more vendors
| Vendor | Country Supplier country. Where available, shows shipping origin. When the supplier ships from a different country than where they are registered, both are shown. Most suppliers show registration country only. | $/g | Pack | Purity |
|---|---|---|---|---|
| Aaron Chemicals LLC | Hong Kong | $4.51 | 100 g | 95% |
| Angene Chemical | China → Hong Kong | $4.70 | 100 g | 95% |
| A2B Chem LLC | United States | $5.00 | 5 g | 95% |
| BLD Pharmatech Ltd. | China | $5.12 | 25 g | 98% |
| BLD Pharmatech Co., Limited | United States | $5.50 | 10 g | 98% |
| BLD Pharmatech GmbH | Germany | $5.50 | 10 g | 98% |
| Ambeed, Inc. | United States | $5.50 | 10 g | 98% |
| AA BLOCKS | United States | $5.60 | 5 g | 95% |
| AK Scientific, Inc. | United States | $9.60 | 5 g | 98% |
| Fluorochem EU | Germany | $15.73 | 1 g | 95% |
| Angene International Limited | United States | $18.40 | 25 g | 98% |
| Apollo Scientific UK | United Kingdom | $21.00 | 1 g | 95% |
| MedChemExpress MCE | Sweden | $39.93 | 5 g | 98% |
| Sigma-Aldrich (Rush Stock) | Germany | $81.23 | 5 g | 97% |
| Sigma-Aldrich | Germany | $81.23 | 5 g | 97% |
| ALFA AESAR | Germany | $102.48 | 1 g | 98% |
| Angene | China → Hong Kong | $4266.67 | 30 mg | 95% |
Chemical Identity
CAS10526-80-4
PubChem CIDNo data available
DTXSIDDTXSID3065110
FormulaC9H18NO6P
Mol. Weight267.218 g/mol
SMILESNC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O
Data Sources
CAS 10526-80-42026-04-29
https://www.epa.gov/tsca-inventory
Archive: data/sources/tsca/tsca_inventory.csv